C8H17NO — CID 55291364
2,3-dimethylhexanamide (PubChem CID 55291364) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2,3-dimethylhexanamide.
| Compound Name | 2,3-dimethylhexanamide |
|---|---|
| PubChem CID | 55291364 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2,3-dimethylhexanamide |
| SMILES | CCCC(C)C(C)C(N)=O |
| InChI | InChI=1S/C8H17NO/c1-4-5-6(2)7(3)8(9)10/h6-7H,4-5H2,1-3H3,(H2,9,10) |
| InChIKey | QRHGBXWTVIEMKQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |