C6H15NO — CID 158835184
methane;2-methylbutanamide (PubChem CID 158835184) has the molecular formula C6H15NO and a molecular weight of 117.19 g/mol. Its IUPAC name is methane;2-methylbutanamide.
| Compound Name | methane;2-methylbutanamide |
|---|---|
| PubChem CID | 158835184 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | methane;2-methylbutanamide |
| SMILES | C.CCC(C)C(N)=O |
| InChI | InChI=1S/C5H11NO.CH4/c1-3-4(2)5(6)7;/h4H,3H2,1-2H3,(H2,6,7);1H4 |
| InChIKey | IXNSITWAZAQUMQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |