C7H13NO3 — CID 90898555
2-methylbutanamide;oxaldehyde (PubChem CID 90898555) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-methylbutanamide;oxaldehyde.
| Compound Name | 2-methylbutanamide;oxaldehyde |
|---|---|
| PubChem CID | 90898555 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-methylbutanamide;oxaldehyde |
| SMILES | CCC(C)C(N)=O.O=CC=O |
| InChI | InChI=1S/C5H11NO.C2H2O2/c1-3-4(2)5(6)7;3-1-2-4/h4H,3H2,1-2H3,(H2,6,7);1-2H |
| InChIKey | YFJZQKYUNSRELW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|