About 4-methyl-3-oxohexanamide
4-methyl-3-oxohexanamide (PubChem CID 91421150) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-methyl-3-oxohexanamide.
Molecular Properties
| Compound Name | 4-methyl-3-oxohexanamide |
| PubChem CID | 91421150 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 4-methyl-3-oxohexanamide |
| SMILES | CCC(C)C(=O)CC(N)=O |
| InChI | InChI=1S/C7H13NO2/c1-3-5(2)6(9)4-7(8)10/h5H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | GVLUIDFSVFWIHI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-oxohexanamide?
The IUPAC name of 4-methyl-3-oxohexanamide (CID 91421150) is 4-methyl-3-oxohexanamide.
What is the SMILES notation for 4-methyl-3-oxohexanamide?
The canonical SMILES for 4-methyl-3-oxohexanamide is CCC(C)C(=O)CC(N)=O.
What is the InChIKey of 4-methyl-3-oxohexanamide?
The InChIKey is GVLUIDFSVFWIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-5(2)6(9)4-7(8)10/h5H,3-4H2,1-2H3,(H2,8,10).
What are the key properties of 4-methyl-3-oxohexanamide?
4-methyl-3-oxohexanamide has a molecular weight of 143.19 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-oxohexanamide is sourced from PubChem (CID 91421150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).