C8H15NO2 — CID 87390570
4,5-dimethyl-3-oxohexanamide (PubChem CID 87390570) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4,5-dimethyl-3-oxohexanamide.
| Compound Name | 4,5-dimethyl-3-oxohexanamide |
|---|---|
| PubChem CID | 87390570 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4,5-dimethyl-3-oxohexanamide |
| SMILES | CC(C)C(C)C(=O)CC(N)=O |
| InChI | InChI=1S/C8H15NO2/c1-5(2)6(3)7(10)4-8(9)11/h5-6H,4H2,1-3H3,(H2,9,11) |
| InChIKey | TZSIOAQCXVXEAN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|