C10H18O — CID 115780430
2,5,6-trimethylhept-1-en-4-one (PubChem CID 115780430) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,5,6-trimethylhept-1-en-4-one.
| Compound Name | 2,5,6-trimethylhept-1-en-4-one |
|---|---|
| PubChem CID | 115780430 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2,5,6-trimethylhept-1-en-4-one |
| SMILES | C=C(C)CC(=O)C(C)C(C)C |
| InChI | InChI=1S/C10H18O/c1-7(2)6-10(11)9(5)8(3)4/h8-9H,1,6H2,2-5H3 |
| InChIKey | IGFLWMXVBAYKKH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|