C10H19NO — CID 116565362
1-(ethylamino)-2,5-dimethylhex-5-en-3-one (PubChem CID 116565362) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(ethylamino)-2,5-dimethylhex-5-en-3-one.
| Compound Name | 1-(ethylamino)-2,5-dimethylhex-5-en-3-one |
|---|---|
| PubChem CID | 116565362 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(ethylamino)-2,5-dimethylhex-5-en-3-one |
| SMILES | C=C(C)CC(=O)C(C)CNCC |
| InChI | InChI=1S/C10H19NO/c1-5-11-7-9(4)10(12)6-8(2)3/h9,11H,2,5-7H2,1,3-4H3 |
| InChIKey | QCOPEHNGKVMDPT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|