C10H19NO — CID 123981814
3,4,5-trimethylhept-3-enamide (PubChem CID 123981814) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,4,5-trimethylhept-3-enamide.
| Compound Name | 3,4,5-trimethylhept-3-enamide |
|---|---|
| PubChem CID | 123981814 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3,4,5-trimethylhept-3-enamide |
| SMILES | CCC(C)C(C)=C(C)CC(N)=O |
| InChI | InChI=1S/C10H19NO/c1-5-7(2)9(4)8(3)6-10(11)12/h7H,5-6H2,1-4H3,(H2,11,12) |
| InChIKey | CQBWKBLDIJRCEL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|