C9H18O — CID 12580686
2,5-dimethylheptan-4-one (PubChem CID 12580686) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is 2,5-dimethylheptan-4-one.
| Compound Name | 2,5-dimethylheptan-4-one |
|---|---|
| PubChem CID | 12580686 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2,5-dimethylheptan-4-one |
| SMILES | CCC(C)C(=O)CC(C)C |
| InChI | InChI=1S/C9H18O/c1-5-8(4)9(10)6-7(2)3/h7-8H,5-6H2,1-4H3 |
| InChIKey | AHXADOAHIKYQRT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |