About 4,7-dimethyl-5-oxooctanal
4,7-dimethyl-5-oxooctanal (PubChem CID 57274522) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 4,7-dimethyl-5-oxooctanal.
Molecular Properties
| Compound Name | 4,7-dimethyl-5-oxooctanal |
| PubChem CID | 57274522 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 4,7-dimethyl-5-oxooctanal |
| SMILES | CC(C)CC(=O)C(C)CCC=O |
| InChI | InChI=1S/C10H18O2/c1-8(2)7-10(12)9(3)5-4-6-11/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | UVKKOWHXSRHXPV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-5-oxooctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-5-oxooctanal?
The IUPAC name of 4,7-dimethyl-5-oxooctanal (CID 57274522) is 4,7-dimethyl-5-oxooctanal.
What is the SMILES notation for 4,7-dimethyl-5-oxooctanal?
The canonical SMILES for 4,7-dimethyl-5-oxooctanal is CC(C)CC(=O)C(C)CCC=O.
What is the InChIKey of 4,7-dimethyl-5-oxooctanal?
The InChIKey is UVKKOWHXSRHXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-8(2)7-10(12)9(3)5-4-6-11/h6,8-9H,4-5,7H2,1-3H3.
What are the key properties of 4,7-dimethyl-5-oxooctanal?
4,7-dimethyl-5-oxooctanal has a molecular weight of 170.25 g/mol, XLogP of 2.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-5-oxooctanal is sourced from PubChem (CID 57274522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).