C7H13NO2 — CID 20693317
N,2-dimethyl-5-oxopentanamide (PubChem CID 20693317) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is N,2-dimethyl-5-oxopentanamide.
| Compound Name | N,2-dimethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 20693317 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N,2-dimethyl-5-oxopentanamide |
| SMILES | CNC(=O)C(C)CCC=O |
| InChI | InChI=1S/C7H13NO2/c1-6(4-3-5-9)7(10)8-2/h5-6H,3-4H2,1-2H3,(H,8,10) |
| InChIKey | INTXXVABFLAWAE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|