C14H23N2O2P — CID 170749132
2-anilino-N-methyl-5-oxopentanamide;ethylphosphane (PubChem CID 170749132) has the molecular formula C14H23N2O2P and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-anilino-N-methyl-5-oxopentanamide;ethylphosphane.
| Compound Name | 2-anilino-N-methyl-5-oxopentanamide;ethylphosphane |
|---|---|
| PubChem CID | 170749132 |
| Molecular Formula | C14H23N2O2P |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-anilino-N-methyl-5-oxopentanamide;ethylphosphane |
| SMILES | CCP.CNC(=O)C(CCC=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2.C2H7P/c1-13-12(16)11(8-5-9-15)14-10-6-3-2-4-7-10;1-2-3/h2-4,6-7,9,11,14H,5,8H2,1H3,(H,13,16);2-3H2,1H3 |
| InChIKey | AWGMRWQNVNFTAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|