C12H18N2O — CID 137320686
2-anilino-N,N-dimethylbutanamide (PubChem CID 137320686) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-anilino-N,N-dimethylbutanamide.
| Compound Name | 2-anilino-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 137320686 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-anilino-N,N-dimethylbutanamide |
| SMILES | CCC(Nc1ccccc1)C(=O)N(C)C |
| InChI | InChI=1S/C12H18N2O/c1-4-11(12(15)14(2)3)13-10-8-6-5-7-9-10/h5-9,11,13H,4H2,1-3H3 |
| InChIKey | WBPVLYDFWDPXFT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |