C25H33BrN2O — CID 91549190
2-anilino-3-[4-(2-bromocyclooctyl)phenyl]-N,N-dimethylpropanamide (PubChem CID 91549190) has the molecular formula C25H33BrN2O and a molecular weight of 457.46 g/mol. Its IUPAC name is 2-anilino-3-[4-(2-bromocyclooctyl)phenyl]-N,N-dimethylpropanamide.
| Compound Name | 2-anilino-3-[4-(2-bromocyclooctyl)phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 91549190 |
| Molecular Formula | C25H33BrN2O |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-anilino-3-[4-(2-bromocyclooctyl)phenyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(Cc1ccc(C2CCCCCCC2Br)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C25H33BrN2O/c1-28(2)25(29)24(27-21-10-6-5-7-11-21)18-19-14-16-20(17-15-19)22-12-8-3-4-9-13-23(22)26/h5-7,10-11,14-17,22-24,27H,3-4,8-9,12-13,18H2,1-2H3 |
| InChIKey | GDMIWDIBJRABNR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|