About (2-bromocyclohexyl)benzene;propanal
(2-bromocyclohexyl)benzene;propanal (PubChem CID 174523163) has the molecular formula C15H21BrO
and a molecular weight of 297.24 g/mol. Its IUPAC name is (2-bromocyclohexyl)benzene;propanal.
Molecular Properties
| Compound Name | (2-bromocyclohexyl)benzene;propanal |
| PubChem CID | 174523163 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2-bromocyclohexyl)benzene;propanal |
| SMILES | BrC1CCCCC1c1ccccc1.CCC=O |
| InChI | InChI=1S/C12H15Br.C3H6O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-4/h1-3,6-7,11-12H,4-5,8-9H2;3H,2H2,1H3 |
| InChIKey | CCFRUSNMIOVPFL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-bromocyclohexyl)benzene;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromocyclohexyl)benzene;propanal?
The IUPAC name of (2-bromocyclohexyl)benzene;propanal (CID 174523163) is (2-bromocyclohexyl)benzene;propanal.
What is the SMILES notation for (2-bromocyclohexyl)benzene;propanal?
The canonical SMILES for (2-bromocyclohexyl)benzene;propanal is BrC1CCCCC1c1ccccc1.CCC=O.
What is the InChIKey of (2-bromocyclohexyl)benzene;propanal?
The InChIKey is CCFRUSNMIOVPFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Br.C3H6O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-4/h1-3,6-7,11-12H,4-5,8-9H2;3H,2H2,1H3.
What are the key properties of (2-bromocyclohexyl)benzene;propanal?
(2-bromocyclohexyl)benzene;propanal has a molecular weight of 297.24 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromocyclohexyl)benzene;propanal is sourced from PubChem (CID 174523163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).