About diphenylmethanone;2-phenylcyclohexan-1-ol;propanal
diphenylmethanone;2-phenylcyclohexan-1-ol;propanal (PubChem CID 175312849) has the molecular formula C28H32O3
and a molecular weight of 416.56 g/mol. Its IUPAC name is diphenylmethanone;2-phenylcyclohexan-1-ol;propanal.
Molecular Properties
| Compound Name | diphenylmethanone;2-phenylcyclohexan-1-ol;propanal |
| PubChem CID | 175312849 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | diphenylmethanone;2-phenylcyclohexan-1-ol;propanal |
| SMILES | CCC=O.O=C(c1ccccc1)c1ccccc1.OC1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C13H10O.C12H16O.C3H6O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-4/h1-10H;1-3,6-7,11-13H,4-5,8-9H2;3H,2H2,1H3 |
| InChIKey | QALBPYCUNXWGTL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;2-phenylcyclohexan-1-ol;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;2-phenylcyclohexan-1-ol;propanal?
The IUPAC name of diphenylmethanone;2-phenylcyclohexan-1-ol;propanal (CID 175312849) is diphenylmethanone;2-phenylcyclohexan-1-ol;propanal.
What is the SMILES notation for diphenylmethanone;2-phenylcyclohexan-1-ol;propanal?
The canonical SMILES for diphenylmethanone;2-phenylcyclohexan-1-ol;propanal is CCC=O.O=C(c1ccccc1)c1ccccc1.OC1CCCCC1c1ccccc1.
What is the InChIKey of diphenylmethanone;2-phenylcyclohexan-1-ol;propanal?
The InChIKey is QALBPYCUNXWGTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C12H16O.C3H6O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-4/h1-10H;1-3,6-7,11-13H,4-5,8-9H2;3H,2H2,1H3.
What are the key properties of diphenylmethanone;2-phenylcyclohexan-1-ol;propanal?
diphenylmethanone;2-phenylcyclohexan-1-ol;propanal has a molecular weight of 416.56 g/mol, XLogP of 6.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;2-phenylcyclohexan-1-ol;propanal is sourced from PubChem (CID 175312849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).