C21H24O — CID 144802014
(4-ethylphenyl)-(2-phenylcyclohexyl)methanone (PubChem CID 144802014) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (4-ethylphenyl)-(2-phenylcyclohexyl)methanone.
| Compound Name | (4-ethylphenyl)-(2-phenylcyclohexyl)methanone |
|---|---|
| PubChem CID | 144802014 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (4-ethylphenyl)-(2-phenylcyclohexyl)methanone |
| SMILES | CCc1ccc(C(=O)C2CCCCC2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O/c1-2-16-12-14-18(15-13-16)21(22)20-11-7-6-10-19(20)17-8-4-3-5-9-17/h3-5,8-9,12-15,19-20H,2,6-7,10-11H2,1H3 |
| InChIKey | JSOQOORCQINHIC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |