C16H18O4 — CID 68735067
2-[4-(2-oxopropanoyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 68735067) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[4-(2-oxopropanoyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[4-(2-oxopropanoyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 68735067 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-[4-(2-oxopropanoyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(=O)C(=O)c1ccc(C2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C16H18O4/c1-10(17)15(18)12-8-6-11(7-9-12)13-4-2-3-5-14(13)16(19)20/h6-9,13-14H,2-5H2,1H3,(H,19,20) |
| InChIKey | CWJNXBZQRIRWRD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|