C13H15BrO2 — CID 71385887
trans-(1R,2R)-2-(4-bromophenyl)cyclohexane-1-carboxylic acid (PubChem CID 71385887) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-bromophenyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-(4-bromophenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 71385887 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | trans-(1R,2R)-2-(4-bromophenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCC[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15BrO2/c14-10-7-5-9(6-8-10)11-3-1-2-4-12(11)13(15)16/h5-8,11-12H,1-4H2,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | LJFIESADSDUNKU-NWDGAFQWSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |