C16H20O3 — CID 24722438
trans-(1R,2R)-2-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid (PubChem CID 24722438) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 24722438 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | trans-(1R,2R)-2-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid |
| SMILES | CCc1ccc(C(=O)[C@@H]2CCCC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C16H20O3/c1-2-11-7-9-12(10-8-11)15(17)13-5-3-4-6-14(13)16(18)19/h7-10,13-14H,2-6H2,1H3,(H,18,19)/t13-,14-/m1/s1 |
| InChIKey | QDQFMUNMHVYHFQ-ZIAGYGMSSA-N |
| XLogP | 3.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |