C21H22O5 — CID 175435053
cyclohexane-1,2-dicarboxylic acid;diphenylmethanone (PubChem CID 175435053) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is cyclohexane-1,2-dicarboxylic acid;diphenylmethanone.
| Compound Name | cyclohexane-1,2-dicarboxylic acid;diphenylmethanone |
|---|---|
| PubChem CID | 175435053 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | cyclohexane-1,2-dicarboxylic acid;diphenylmethanone |
| SMILES | O=C(O)C1CCCCC1C(=O)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C8H12O4/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-10H;5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | MLBAAAHEVSCUHA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |