C21H20ClNO4 — CID 40548385
cis-(1R,2S)-2-[(2-benzoyl-4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 40548385) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(2-benzoyl-4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[(2-benzoyl-4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 40548385 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | cis-(1R,2S)-2-[(2-benzoyl-4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NC(=O)[C@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H20ClNO4/c22-14-10-11-18(17(12-14)19(24)13-6-2-1-3-7-13)23-20(25)15-8-4-5-9-16(15)21(26)27/h1-3,6-7,10-12,15-16H,4-5,8-9H2,(H,23,25)(H,26,27)/t15-,16+/m0/s1 |
| InChIKey | CREATWPNHZGQHS-JKSUJKDBSA-N |
| XLogP | 4.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |