C27H22Cl2N2O3 — CID 18873769
2-N-(2-benzoyl-4-chlorophenyl)-1-N-(4-chlorophenyl)cyclohex-4-ene-1,2-dicarboxamide (PubChem CID 18873769) has the molecular formula C27H22Cl2N2O3 and a molecular weight of 493.39 g/mol. Its IUPAC name is 2-N-(2-benzoyl-4-chlorophenyl)-1-N-(4-chlorophenyl)cyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 2-N-(2-benzoyl-4-chlorophenyl)-1-N-(4-chlorophenyl)cyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 18873769 |
| Molecular Formula | C27H22Cl2N2O3 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-N-(2-benzoyl-4-chlorophenyl)-1-N-(4-chlorophenyl)cyclohex-4-ene-1,2-dicarboxamide |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NC(=O)C1CC=CCC1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O3/c28-18-10-13-20(14-11-18)30-26(33)21-8-4-5-9-22(21)27(34)31-24-15-12-19(29)16-23(24)25(32)17-6-2-1-3-7-17/h1-7,10-16,21-22H,8-9H2,(H,30,33)(H,31,34) |
| InChIKey | BFEPDYMTOVGHHU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|