C19H18ClN3O2 — CID 18873761
1-N-(4-chlorophenyl)-2-N-pyridin-4-ylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 18873761) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-2-N-pyridin-4-ylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 1-N-(4-chlorophenyl)-2-N-pyridin-4-ylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 18873761 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-N-(4-chlorophenyl)-2-N-pyridin-4-ylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccncc1)C1CC=CCC1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN3O2/c20-13-5-7-14(8-6-13)22-18(24)16-3-1-2-4-17(16)19(25)23-15-9-11-21-12-10-15/h1-2,5-12,16-17H,3-4H2,(H,22,24)(H,21,23,25) |
| InChIKey | VRTNDVWNFLHBGR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|