C26H28N2O3 — CID 19133594
N-(2-benzoyl-4-methylphenyl)-6-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 19133594) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-6-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-6-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 19133594 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-6-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC=CCC2C(=O)N2CCCC2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O3/c1-18-13-14-23(22(17-18)24(29)19-9-3-2-4-10-19)27-25(30)20-11-5-6-12-21(20)26(31)28-15-7-8-16-28/h2-6,9-10,13-14,17,20-21H,7-8,11-12,15-16H2,1H3,(H,27,30) |
| InChIKey | JLBUXIMXHPJNQK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|