C33H27BrN2O3 — CID 19133790
1-N-(2-benzoyl-4-bromophenyl)-2-N,2-N-diphenylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 19133790) has the molecular formula C33H27BrN2O3 and a molecular weight of 579.49 g/mol. Its IUPAC name is 1-N-(2-benzoyl-4-bromophenyl)-2-N,2-N-diphenylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 1-N-(2-benzoyl-4-bromophenyl)-2-N,2-N-diphenylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 19133790 |
| Molecular Formula | C33H27BrN2O3 |
| Molecular Weight | 579.49 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | 1-N-(2-benzoyl-4-bromophenyl)-2-N,2-N-diphenylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | O=C(c1ccccc1)c1cc(Br)ccc1NC(=O)C1CC=CCC1C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H27BrN2O3/c34-24-20-21-30(29(22-24)31(37)23-12-4-1-5-13-23)35-32(38)27-18-10-11-19-28(27)33(39)36(25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1-17,20-22,27-28H,18-19H2,(H,35,38) |
| InChIKey | KBIPCGDKFNBKSK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.49 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|