C17H20N2O4 — CID 23474978
2-[[6-(dimethylcarbamoyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid (PubChem CID 23474978) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[[6-(dimethylcarbamoyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[6-(dimethylcarbamoyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23474978 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[[6-(dimethylcarbamoyl)cyclohex-3-ene-1-carbonyl]amino]benzoic acid |
| SMILES | CN(C)C(=O)C1CC=CCC1C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C17H20N2O4/c1-19(2)16(21)12-8-4-3-7-11(12)15(20)18-14-10-6-5-9-13(14)17(22)23/h3-6,9-12H,7-8H2,1-2H3,(H,18,20)(H,22,23) |
| InChIKey | AQXMDLAMTUYQSN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|