C29H30N2O2 — CID 19133723
2-N,2-N-dibenzyl-1-N-(2-methylphenyl)cyclohex-4-ene-1,2-dicarboxamide (PubChem CID 19133723) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-N,2-N-dibenzyl-1-N-(2-methylphenyl)cyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 2-N,2-N-dibenzyl-1-N-(2-methylphenyl)cyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 19133723 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-N,2-N-dibenzyl-1-N-(2-methylphenyl)cyclohex-4-ene-1,2-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)C1CC=CCC1C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H30N2O2/c1-22-12-8-11-19-27(22)30-28(32)25-17-9-10-18-26(25)29(33)31(20-23-13-4-2-5-14-23)21-24-15-6-3-7-16-24/h2-16,19,25-26H,17-18,20-21H2,1H3,(H,30,32) |
| InChIKey | ZXXKFPLZBUOJGC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|