C14H15FO3 — CID 24722440
trans-(1R,2R)-2-(3-fluorobenzoyl)cyclohexane-1-carboxylic acid (PubChem CID 24722440) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-fluorobenzoyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-(3-fluorobenzoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 24722440 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | trans-(1R,2R)-2-(3-fluorobenzoyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCC[C@H]1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H15FO3/c15-10-5-3-4-9(8-10)13(16)11-6-1-2-7-12(11)14(17)18/h3-5,8,11-12H,1-2,6-7H2,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | YJIFMHRCDUOGST-VXGBXAGGSA-N |
| XLogP | 2.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |