carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene

C14H18O2 — CID 123742009

IUPACcarbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene
SMILESC[C@H]1CCCC[C@@H]1c1ccccc1.O=C=O
InChIInChI=1S/C13H18.CO2/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2-1-3/h2-4,8-9,11,13H,5-7,10H2,1H3;/t11-,13-;/m0./s1
InChIKeyQZUHHDUFQGZRPA-JZKFLRDJSA-N
MW218.30 g/mol
LogP3.40
Rot. Bonds1

About carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene

carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene (PubChem CID 123742009) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene.

Molecular Properties

Compound Namecarbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene
PubChem CID123742009
Molecular FormulaC14H18O2
Molecular Weight218.30 g/mol
Exact Mass218.13
IUPAC Namecarbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene
SMILESC[C@H]1CCCC[C@@H]1c1ccccc1.O=C=O
InChIInChI=1S/C13H18.CO2/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2-1-3/h2-4,8-9,11,13H,5-7,10H2,1H3;/t11-,13-;/m0./s1
InChIKeyQZUHHDUFQGZRPA-JZKFLRDJSA-N
XLogP3.40
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.30
LogP ≤ 53.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene?
The IUPAC name of carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene (CID 123742009) is carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene.
What is the SMILES notation for carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene?
The canonical SMILES for carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene is C[C@H]1CCCC[C@@H]1c1ccccc1.O=C=O.
What is the InChIKey of carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene?
The InChIKey is QZUHHDUFQGZRPA-JZKFLRDJSA-N. The full InChI is InChI=1S/C13H18.CO2/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2-1-3/h2-4,8-9,11,13H,5-7,10H2,1H3;/t11-,13-;/m0./s1.
What are the key properties of carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene?
carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene has a molecular weight of 218.30 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;[(1S,2S)-2-methylcyclohexyl]benzene is sourced from PubChem (CID 123742009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).