C21H25NO4S — CID 45290696
(2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 45290696) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 45290696 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2S)-2-[(4-cyclohexylphenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25NO4S/c23-21(24)20(15-16-7-3-1-4-8-16)22-27(25,26)19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1,3-4,7-8,11-14,17,20,22H,2,5-6,9-10,15H2,(H,23,24)/t20-/m0/s1 |
| InChIKey | QEZHKZSPRKTUBL-FQEVSTJZSA-N |
| XLogP | 3.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |