C20H24N4O4S — CID 42531153
(2S)-3-phenyl-2-[[4-(piperidin-1-yldiazenyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 42531153) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[4-(piperidin-1-yldiazenyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[4-(piperidin-1-yldiazenyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 42531153 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (2S)-3-phenyl-2-[[4-(piperidin-1-yldiazenyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(/N=N/N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c25-20(26)19(15-16-7-3-1-4-8-16)22-29(27,28)18-11-9-17(10-12-18)21-23-24-13-5-2-6-14-24/h1,3-4,7-12,19,22H,2,5-6,13-15H2,(H,25,26)/b23-21+/t19-/m0/s1 |
| InChIKey | JPJJFZMHMZRKQQ-KFGJJWJMSA-N |
| XLogP | 3.15 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|