C20H22K2N4O4S — CID 6514282
dipotassium;3-phenyl-2-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylazanidylpropanoate (PubChem CID 6514282) has the molecular formula C20H22K2N4O4S and a molecular weight of 492.68 g/mol. Its IUPAC name is dipotassium;3-phenyl-2-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylazanidylpropanoate.
| Compound Name | dipotassium;3-phenyl-2-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylazanidylpropanoate |
|---|---|
| PubChem CID | 6514282 |
| Molecular Formula | C20H22K2N4O4S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | dipotassium;3-phenyl-2-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylazanidylpropanoate |
| SMILES | O=C([O-])C(Cc1ccccc1)[N-]S(=O)(=O)c1ccc(/N=N/N2CCCCC2)cc1.[K+].[K+] |
| InChI | InChI=1S/C20H23N4O4S.2K/c25-20(26)19(15-16-7-3-1-4-8-16)22-29(27,28)18-11-9-17(10-12-18)21-23-24-13-5-2-6-14-24;;/h1,3-4,7-12,19H,2,5-6,13-15H2,(H,25,26);;/q-1;2*+1/p-1/b23-21+;; |
| InChIKey | QVRIQQJIGINTLI-GUSGXMBRSA-M |
| XLogP | -3.40 |
| TPSA | 116.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|