C17H29N5O5S — CID 17388729
2-(2-hydroxyethylamino)ethanol;N-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylacetamide (PubChem CID 17388729) has the molecular formula C17H29N5O5S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;N-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylacetamide.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;N-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 17388729 |
| Molecular Formula | C17H29N5O5S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;N-[4-(piperidin-1-yldiazenyl)phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(/N=N/N2CCCCC2)cc1.OCCNCCO |
| InChI | InChI=1S/C13H18N4O3S.C4H11NO2/c1-11(18)15-21(19,20)13-7-5-12(6-8-13)14-16-17-9-3-2-4-10-17;6-3-1-5-2-4-7/h5-8H,2-4,9-10H2,1H3,(H,15,18);5-7H,1-4H2/b16-14+; |
| InChIKey | KAIJHWGGMHYKPQ-BACBYAOASA-N |
| XLogP | 0.56 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|