C14H17N3O6S — CID 135628605
ethyl (E)-2-[[4-(acetylsulfamoyl)phenyl]diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135628605) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is ethyl (E)-2-[[4-(acetylsulfamoyl)phenyl]diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[[4-(acetylsulfamoyl)phenyl]diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135628605 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl (E)-2-[[4-(acetylsulfamoyl)phenyl]diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(S(=O)(=O)NC(C)=O)cc1)=C(/C)O |
| InChI | InChI=1S/C14H17N3O6S/c1-4-23-14(20)13(9(2)18)16-15-11-5-7-12(8-6-11)24(21,22)17-10(3)19/h5-8,18H,4H2,1-3H3,(H,17,19)/b13-9+,16-15+ |
| InChIKey | GVBYNWWXIIRMAG-YOXRYGNQSA-N |
| XLogP | 1.95 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|