C12H15N3O5S — CID 135465043
ethyl 3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate (PubChem CID 135465043) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate.
| Compound Name | ethyl 3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate |
|---|---|
| PubChem CID | 135465043 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | ethyl 3-hydroxy-2-[(4-sulfamoylphenyl)diazenyl]but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(S(N)(=O)=O)cc1)=C(C)O |
| InChI | InChI=1S/C12H15N3O5S/c1-3-20-12(17)11(8(2)16)15-14-9-4-6-10(7-5-9)21(13,18)19/h4-7,16H,3H2,1-2H3,(H2,13,18,19)/b11-8?,15-14+ |
| InChIKey | UFDGJCZXVTXUNH-OZKPHRKMSA-N |
| XLogP | 1.77 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|