C12H15N3O5S — CID 98394400
ethyl (2R)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanoate (PubChem CID 98394400) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is ethyl (2R)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanoate.
| Compound Name | ethyl (2R)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanoate |
|---|---|
| PubChem CID | 98394400 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | ethyl (2R)-3-oxo-2-[(4-sulfamoylphenyl)diazenyl]butanoate |
| SMILES | CCOC(=O)[C@H](/N=N/c1ccc(S(N)(=O)=O)cc1)C(C)=O |
| InChI | InChI=1S/C12H15N3O5S/c1-3-20-12(17)11(8(2)16)15-14-9-4-6-10(7-5-9)21(13,18)19/h4-7,11H,3H2,1-2H3,(H2,13,18,19)/b15-14+/t11-/m1/s1 |
| InChIKey | OPFIYHKEUYUKOO-BFWGRDPESA-N |
| XLogP | 0.94 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|