C9H11N3O3S — CID 102356354
ethyl 3-oxo-2-(1,3-thiazol-2-yldiazenyl)butanoate (PubChem CID 102356354) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is ethyl 3-oxo-2-(1,3-thiazol-2-yldiazenyl)butanoate.
| Compound Name | ethyl 3-oxo-2-(1,3-thiazol-2-yldiazenyl)butanoate |
|---|---|
| PubChem CID | 102356354 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | ethyl 3-oxo-2-(1,3-thiazol-2-yldiazenyl)butanoate |
| SMILES | CCOC(=O)C(/N=N/c1nccs1)C(C)=O |
| InChI | InChI=1S/C9H11N3O3S/c1-3-15-8(14)7(6(2)13)11-12-9-10-4-5-16-9/h4-5,7H,3H2,1-2H3/b12-11+ |
| InChIKey | SEMNTRFKLYTXBV-VAWYXSNFSA-N |
| XLogP | 1.75 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|