C8H9NO4S — CID 174640375
1-O-ethyl 3-O-(1,3-thiazol-2-yl) propanedioate (PubChem CID 174640375) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(1,3-thiazol-2-yl) propanedioate.
| Compound Name | 1-O-ethyl 3-O-(1,3-thiazol-2-yl) propanedioate |
|---|---|
| PubChem CID | 174640375 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 1-O-ethyl 3-O-(1,3-thiazol-2-yl) propanedioate |
| SMILES | CCOC(=O)CC(=O)Oc1nccs1 |
| InChI | InChI=1S/C8H9NO4S/c1-2-12-6(10)5-7(11)13-8-9-3-4-14-8/h3-4H,2,5H2,1H3 |
| InChIKey | KEQQVQCEWRYWST-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|