C14H15NO3S — CID 12785117
ethyl 2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate (PubChem CID 12785117) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is ethyl 2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate.
| Compound Name | ethyl 2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 12785117 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | ethyl 2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(C)c1ccc(Oc2nccs2)cc1 |
| InChI | InChI=1S/C14H15NO3S/c1-3-17-13(16)10(2)11-4-6-12(7-5-11)18-14-15-8-9-19-14/h4-10H,3H2,1-2H3 |
| InChIKey | JOUDNFRFTFKDOZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |