About propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate
propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate (PubChem CID 70538271) has the molecular formula C16H19NO3S
and a molecular weight of 305.40 g/mol. Its IUPAC name is propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate |
| PubChem CID | 70538271 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate |
| SMILES | CC(C)OC(=O)C(C)(C)c1ccc(Oc2nccs2)cc1 |
| InChI | InChI=1S/C16H19NO3S/c1-11(2)19-14(18)16(3,4)12-5-7-13(8-6-12)20-15-17-9-10-21-15/h5-11H,1-4H3 |
| InChIKey | BDLORCDCLKSMRT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate?
The IUPAC name of propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate (CID 70538271) is propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate.
What is the SMILES notation for propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate?
The canonical SMILES for propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate is CC(C)OC(=O)C(C)(C)c1ccc(Oc2nccs2)cc1.
What is the InChIKey of propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate?
The InChIKey is BDLORCDCLKSMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3S/c1-11(2)19-14(18)16(3,4)12-5-7-13(8-6-12)20-15-17-9-10-21-15/h5-11H,1-4H3.
What are the key properties of propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate?
propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate has a molecular weight of 305.40 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-methyl-2-[4-(1,3-thiazol-2-yloxy)phenyl]propanoate is sourced from PubChem (CID 70538271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).