C23H18N2O3S — CID 91813720
N-(4-phenylmethoxyphenyl)-4-(1,3-thiazol-2-yloxy)benzamide (PubChem CID 91813720) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-(4-phenylmethoxyphenyl)-4-(1,3-thiazol-2-yloxy)benzamide.
| Compound Name | N-(4-phenylmethoxyphenyl)-4-(1,3-thiazol-2-yloxy)benzamide |
|---|---|
| PubChem CID | 91813720 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-(4-phenylmethoxyphenyl)-4-(1,3-thiazol-2-yloxy)benzamide |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)c1ccc(Oc2nccs2)cc1 |
| InChI | InChI=1S/C23H18N2O3S/c26-22(18-6-10-21(11-7-18)28-23-24-14-15-29-23)25-19-8-12-20(13-9-19)27-16-17-4-2-1-3-5-17/h1-15H,16H2,(H,25,26) |
| InChIKey | MLULYQZTAUDXDL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |