About N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide
N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide (PubChem CID 71977190) has the molecular formula C15H18N2O3S
and a molecular weight of 306.39 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide |
| PubChem CID | 71977190 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide |
| SMILES | CC(C)(C)NC(=O)COc1ccc(Oc2nccs2)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-15(2,3)17-13(18)10-19-11-4-6-12(7-5-11)20-14-16-8-9-21-14/h4-9H,10H2,1-3H3,(H,17,18) |
| InChIKey | KHNFDPIHGUDAFO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide?
The IUPAC name of N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide (CID 71977190) is N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide.
What is the SMILES notation for N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide?
The canonical SMILES for N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide is CC(C)(C)NC(=O)COc1ccc(Oc2nccs2)cc1.
What is the InChIKey of N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide?
The InChIKey is KHNFDPIHGUDAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S/c1-15(2,3)17-13(18)10-19-11-4-6-12(7-5-11)20-14-16-8-9-21-14/h4-9H,10H2,1-3H3,(H,17,18).
What are the key properties of N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide?
N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide has a molecular weight of 306.39 g/mol, XLogP of 3.23, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[4-(1,3-thiazol-2-yloxy)phenoxy]acetamide is sourced from PubChem (CID 71977190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).