C17H13NO3S — CID 58188071
3-(4-methylphenyl)-5-(1,3-thiazol-2-yloxy)benzoic acid (PubChem CID 58188071) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(1,3-thiazol-2-yloxy)benzoic acid.
| Compound Name | 3-(4-methylphenyl)-5-(1,3-thiazol-2-yloxy)benzoic acid |
|---|---|
| PubChem CID | 58188071 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-(4-methylphenyl)-5-(1,3-thiazol-2-yloxy)benzoic acid |
| SMILES | Cc1ccc(-c2cc(Oc3nccs3)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H13NO3S/c1-11-2-4-12(5-3-11)13-8-14(16(19)20)10-15(9-13)21-17-18-6-7-22-17/h2-10H,1H3,(H,19,20) |
| InChIKey | WSOWYXWLGCPDNU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |