3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid

C14H9NO3S — CID 61395519

IUPAC3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid
SMILESO=C(O)c1cc2ccccc2cc1Oc1nccs1
InChIInChI=1S/C14H9NO3S/c16-13(17)11-7-9-3-1-2-4-10(9)8-12(11)18-14-15-5-6-19-14/h1-8H,(H,16,17)
InChIKeyGIDOWYPDWZGDJH-UHFFFAOYSA-N
MW271.30 g/mol
LogP3.79
Rot. Bonds3

About 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid

3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid (PubChem CID 61395519) has the molecular formula C14H9NO3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid
PubChem CID61395519
Molecular FormulaC14H9NO3S
Molecular Weight271.30 g/mol
Exact Mass271.03
IUPAC Name3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid
SMILESO=C(O)c1cc2ccccc2cc1Oc1nccs1
InChIInChI=1S/C14H9NO3S/c16-13(17)11-7-9-3-1-2-4-10(9)8-12(11)18-14-15-5-6-19-14/h1-8H,(H,16,17)
InChIKeyGIDOWYPDWZGDJH-UHFFFAOYSA-N
XLogP3.79
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.30
LogP ≤ 53.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid?
The IUPAC name of 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid (CID 61395519) is 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid.
What is the SMILES notation for 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid?
The canonical SMILES for 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid is O=C(O)c1cc2ccccc2cc1Oc1nccs1.
What is the InChIKey of 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid?
The InChIKey is GIDOWYPDWZGDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3S/c16-13(17)11-7-9-3-1-2-4-10(9)8-12(11)18-14-15-5-6-19-14/h1-8H,(H,16,17).
What are the key properties of 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid?
3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid has a molecular weight of 271.30 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-yloxy)naphthalene-2-carboxylic acid is sourced from PubChem (CID 61395519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).