C9H6ClNOS — CID 117189206
2-(2-chlorophenoxy)-1,3-thiazole (PubChem CID 117189206) has the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-1,3-thiazole.
| Compound Name | 2-(2-chlorophenoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 117189206 |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 2-(2-chlorophenoxy)-1,3-thiazole |
| SMILES | Clc1ccccc1Oc1nccs1 |
| InChI | InChI=1S/C9H6ClNOS/c10-7-3-1-2-4-8(7)12-9-11-5-6-13-9/h1-6H |
| InChIKey | XTZBZQBJDGUOSB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |