C16H11Cl2N3O2S — CID 174475178
1-[5-chloro-2-(2-chlorophenoxy)phenyl]-1-(1,3-thiazol-2-yl)urea (PubChem CID 174475178) has the molecular formula C16H11Cl2N3O2S and a molecular weight of 380.26 g/mol. Its IUPAC name is 1-[5-chloro-2-(2-chlorophenoxy)phenyl]-1-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[5-chloro-2-(2-chlorophenoxy)phenyl]-1-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 174475178 |
| Molecular Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 1-[5-chloro-2-(2-chlorophenoxy)phenyl]-1-(1,3-thiazol-2-yl)urea |
| SMILES | NC(=O)N(c1nccs1)c1cc(Cl)ccc1Oc1ccccc1Cl |
| InChI | InChI=1S/C16H11Cl2N3O2S/c17-10-5-6-14(23-13-4-2-1-3-11(13)18)12(9-10)21(15(19)22)16-20-7-8-24-16/h1-9H,(H2,19,22) |
| InChIKey | JRJJELLFBMMUBV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |