C31H22Cl2N2O4S — CID 67166325
2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 67166325) has the molecular formula C31H22Cl2N2O4S and a molecular weight of 589.50 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 67166325 |
| Molecular Formula | C31H22Cl2N2O4S |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 2-[(2-chlorophenyl)methoxy]-N-[2-[(2-chlorophenyl)methoxy]benzoyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(c1ccccc1OCc1ccccc1Cl)N(C(=O)c1ccccc1OCc1ccccc1Cl)c1nccs1 |
| InChI | InChI=1S/C31H22Cl2N2O4S/c32-25-13-5-1-9-21(25)19-38-27-15-7-3-11-23(27)29(36)35(31-34-17-18-40-31)30(37)24-12-4-8-16-28(24)39-20-22-10-2-6-14-26(22)33/h1-18H,19-20H2 |
| InChIKey | DWYSNASORFVZCW-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|