C18H20ClNO2 — CID 13073609
2-[(2-chlorophenyl)methoxy]-N,N-diethylbenzamide (PubChem CID 13073609) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methoxy]-N,N-diethylbenzamide.
| Compound Name | 2-[(2-chlorophenyl)methoxy]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 13073609 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methoxy]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C18H20ClNO2/c1-3-20(4-2)18(21)15-10-6-8-12-17(15)22-13-14-9-5-7-11-16(14)19/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | NQTDYEVEZYMRLG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |