C12H17Cl2NO2 — CID 173020221
2-(chloromethoxy)-N,N-diethylbenzamide;hydrochloride (PubChem CID 173020221) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-(chloromethoxy)-N,N-diethylbenzamide;hydrochloride.
| Compound Name | 2-(chloromethoxy)-N,N-diethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 173020221 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-(chloromethoxy)-N,N-diethylbenzamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1ccccc1OCCl.Cl |
| InChI | InChI=1S/C12H16ClNO2.ClH/c1-3-14(4-2)12(15)10-7-5-6-8-11(10)16-9-13;/h5-8H,3-4,9H2,1-2H3;1H |
| InChIKey | LNFAEGRFXAXZEP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|